C19H18FN7 — CID 171334843
2-fluoro-4-[4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]piperazin-1-yl]benzonitrile (PubChem CID 171334843) has the molecular formula C19H18FN7 and a molecular weight of 363.40 g/mol. Its IUPAC name is 2-fluoro-4-[4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]piperazin-1-yl]benzonitrile.
| Compound Name | 2-fluoro-4-[4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 171334843 |
| Molecular Formula | C19H18FN7 |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 2-fluoro-4-[4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]piperazin-1-yl]benzonitrile |
| SMILES | Cc1ccn(-c2ccc(N3CCN(c4ccc(C#N)c(F)c4)CC3)nn2)n1 |
| InChI | InChI=1S/C19H18FN7/c1-14-6-7-27(24-14)19-5-4-18(22-23-19)26-10-8-25(9-11-26)16-3-2-15(13-21)17(20)12-16/h2-7,12H,8-11H2,1H3 |
| InChIKey | NHUOKGXKPUZZHD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 73.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |