C17H21F3N6 — CID 146079790
N-ethyl-4-methyl-6-[4-[4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]pyrimidin-2-amine (PubChem CID 146079790) has the molecular formula C17H21F3N6 and a molecular weight of 366.39 g/mol. Its IUPAC name is N-ethyl-4-methyl-6-[4-[4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]pyrimidin-2-amine.
| Compound Name | N-ethyl-4-methyl-6-[4-[4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 146079790 |
| Molecular Formula | C17H21F3N6 |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | N-ethyl-4-methyl-6-[4-[4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]pyrimidin-2-amine |
| SMILES | CCNc1nc(C)cc(N2CCN(c3cc(C(F)(F)F)ccn3)CC2)n1 |
| InChI | InChI=1S/C17H21F3N6/c1-3-21-16-23-12(2)10-15(24-16)26-8-6-25(7-9-26)14-11-13(4-5-22-14)17(18,19)20/h4-5,10-11H,3,6-9H2,1-2H3,(H,21,23,24) |
| InChIKey | TYVSHQWTINNLQS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |