C15H20F3N3S — CID 171335362
4-[1-[4-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]thiomorpholine (PubChem CID 171335362) has the molecular formula C15H20F3N3S and a molecular weight of 331.41 g/mol. Its IUPAC name is 4-[1-[4-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]thiomorpholine.
| Compound Name | 4-[1-[4-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]thiomorpholine |
|---|---|
| PubChem CID | 171335362 |
| Molecular Formula | C15H20F3N3S |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 4-[1-[4-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]thiomorpholine |
| SMILES | FC(F)(F)c1ccnc(N2CCC(N3CCSCC3)CC2)c1 |
| InChI | InChI=1S/C15H20F3N3S/c16-15(17,18)12-1-4-19-14(11-12)21-5-2-13(3-6-21)20-7-9-22-10-8-20/h1,4,11,13H,2-3,5-10H2 |
| InChIKey | BEZBPXOEWPLHNT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |