C15H20N6O — CID 171335788
(1-methylpyrazol-3-yl)-[4-[methyl(pyrimidin-4-yl)amino]piperidin-1-yl]methanone (PubChem CID 171335788) has the molecular formula C15H20N6O and a molecular weight of 300.37 g/mol. Its IUPAC name is (1-methylpyrazol-3-yl)-[4-[methyl(pyrimidin-4-yl)amino]piperidin-1-yl]methanone.
| Compound Name | (1-methylpyrazol-3-yl)-[4-[methyl(pyrimidin-4-yl)amino]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 171335788 |
| Molecular Formula | C15H20N6O |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | (1-methylpyrazol-3-yl)-[4-[methyl(pyrimidin-4-yl)amino]piperidin-1-yl]methanone |
| SMILES | CN(c1ccncn1)C1CCN(C(=O)c2ccn(C)n2)CC1 |
| InChI | InChI=1S/C15H20N6O/c1-19-8-6-13(18-19)15(22)21-9-4-12(5-10-21)20(2)14-3-7-16-11-17-14/h3,6-8,11-12H,4-5,9-10H2,1-2H3 |
| InChIKey | KIUMILJXDAVCFU-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |