C14H18O8 — CID 171337235
2-[(2E,4E)-7-carboxy-2-methylocta-2,4-dienoyl]oxybutanedioic acid (PubChem CID 171337235) has the molecular formula C14H18O8 and a molecular weight of 314.29 g/mol. Its IUPAC name is 2-[(2E,4E)-7-carboxy-2-methylocta-2,4-dienoyl]oxybutanedioic acid.
| Compound Name | 2-[(2E,4E)-7-carboxy-2-methylocta-2,4-dienoyl]oxybutanedioic acid |
|---|---|
| PubChem CID | 171337235 |
| Molecular Formula | C14H18O8 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 2-[(2E,4E)-7-carboxy-2-methylocta-2,4-dienoyl]oxybutanedioic acid |
| SMILES | C/C(=C\C=C\CC(C)C(=O)O)C(=O)OC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C14H18O8/c1-8(12(17)18)5-3-4-6-9(2)14(21)22-10(13(19)20)7-11(15)16/h3-4,6,8,10H,5,7H2,1-2H3,(H,15,16)(H,17,18)(H,19,20)/b4-3+,9-6+ |
| InChIKey | KZYDYUNTSSOJFK-JAFPNSLJSA-N |
| XLogP | 1.07 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|