C7H5BrF3N3O — CID 171338494
N'-(4-bromo-2-pyridinyl)-2,2,2-trifluoroacetohydrazide (PubChem CID 171338494) has the molecular formula C7H5BrF3N3O and a molecular weight of 284.04 g/mol. Its IUPAC name is N'-(4-bromo-2-pyridinyl)-2,2,2-trifluoroacetohydrazide.
| Compound Name | N'-(4-bromo-2-pyridinyl)-2,2,2-trifluoroacetohydrazide |
|---|---|
| PubChem CID | 171338494 |
| Molecular Formula | C7H5BrF3N3O |
| Molecular Weight | 284.04 g/mol |
| Exact Mass | 282.96 |
| IUPAC Name | N'-(4-bromo-2-pyridinyl)-2,2,2-trifluoroacetohydrazide |
| SMILES | O=C(NNc1cc(Br)ccn1)C(F)(F)F |
| InChI | InChI=1S/C7H5BrF3N3O/c8-4-1-2-12-5(3-4)13-14-6(15)7(9,10)11/h1-3H,(H,12,13)(H,14,15) |
| InChIKey | YKAZIUWSEVLEKG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.04 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|