C22H26N2O6S — CID 171338722
(3aS,6aS)-N-cyclopropyl-5-[3-(5-thiophen-2-ylfuran-2-yl)propanoyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide;formic acid (PubChem CID 171338722) has the molecular formula C22H26N2O6S and a molecular weight of 446.53 g/mol. Its IUPAC name is (3aS,6aS)-N-cyclopropyl-5-[3-(5-thiophen-2-ylfuran-2-yl)propanoyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide;formic acid.
| Compound Name | (3aS,6aS)-N-cyclopropyl-5-[3-(5-thiophen-2-ylfuran-2-yl)propanoyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide;formic acid |
|---|---|
| PubChem CID | 171338722 |
| Molecular Formula | C22H26N2O6S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | (3aS,6aS)-N-cyclopropyl-5-[3-(5-thiophen-2-ylfuran-2-yl)propanoyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide;formic acid |
| SMILES | O=C(CCc1ccc(-c2cccs2)o1)N1C[C@H]2COC[C@@]2(C(=O)NC2CC2)C1.O=CO |
| InChI | InChI=1S/C21H24N2O4S.CH2O2/c24-19(8-6-16-5-7-17(27-16)18-2-1-9-28-18)23-10-14-11-26-13-21(14,12-23)20(25)22-15-3-4-15;2-1-3/h1-2,5,7,9,14-15H,3-4,6,8,10-13H2,(H,22,25);1H,(H,2,3)/t14-,21-;/m0./s1 |
| InChIKey | LAJRFXFBDAKOTN-KNMWBNGMSA-N |
| XLogP | 2.40 |
| TPSA | 109.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|