C23H32N6O5 — CID 171339074
formic acid;1-[2-[4-(4-methoxyphenyl)-5-(1-methylimidazol-2-yl)imidazol-1-yl]ethyl]-4-methylpiperazine (PubChem CID 171339074) has the molecular formula C23H32N6O5 and a molecular weight of 472.55 g/mol. Its IUPAC name is formic acid;1-[2-[4-(4-methoxyphenyl)-5-(1-methylimidazol-2-yl)imidazol-1-yl]ethyl]-4-methylpiperazine.
| Compound Name | formic acid;1-[2-[4-(4-methoxyphenyl)-5-(1-methylimidazol-2-yl)imidazol-1-yl]ethyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 171339074 |
| Molecular Formula | C23H32N6O5 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | formic acid;1-[2-[4-(4-methoxyphenyl)-5-(1-methylimidazol-2-yl)imidazol-1-yl]ethyl]-4-methylpiperazine |
| SMILES | COc1ccc(-c2ncn(CCN3CCN(C)CC3)c2-c2nccn2C)cc1.O=CO.O=CO |
| InChI | InChI=1S/C21H28N6O.2CH2O2/c1-24-10-12-26(13-11-24)14-15-27-16-23-19(17-4-6-18(28-3)7-5-17)20(27)21-22-8-9-25(21)2;2*2-1-3/h4-9,16H,10-15H2,1-3H3;2*1H,(H,2,3) |
| InChIKey | QRKUVTYRUCSINM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 125.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|