C20H29N3O5S — CID 171710035
N-[2-[5-cyclohexyl-4-(4-methoxyphenyl)imidazol-1-yl]ethyl]methanesulfonamide;formic acid (PubChem CID 171710035) has the molecular formula C20H29N3O5S and a molecular weight of 423.54 g/mol. Its IUPAC name is N-[2-[5-cyclohexyl-4-(4-methoxyphenyl)imidazol-1-yl]ethyl]methanesulfonamide;formic acid.
| Compound Name | N-[2-[5-cyclohexyl-4-(4-methoxyphenyl)imidazol-1-yl]ethyl]methanesulfonamide;formic acid |
|---|---|
| PubChem CID | 171710035 |
| Molecular Formula | C20H29N3O5S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | N-[2-[5-cyclohexyl-4-(4-methoxyphenyl)imidazol-1-yl]ethyl]methanesulfonamide;formic acid |
| SMILES | COc1ccc(-c2ncn(CCNS(C)(=O)=O)c2C2CCCCC2)cc1.O=CO |
| InChI | InChI=1S/C19H27N3O3S.CH2O2/c1-25-17-10-8-15(9-11-17)18-19(16-6-4-3-5-7-16)22(14-20-18)13-12-21-26(2,23)24;2-1-3/h8-11,14,16,21H,3-7,12-13H2,1-2H3;1H,(H,2,3) |
| InChIKey | KJGZTFMQZGXVFQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|