C23H29N3O4 — CID 171710054
1-[2-[5-cyclohex-3-en-1-yl-4-(3-methoxyphenyl)imidazol-1-yl]ethyl]pyrrolidin-2-one;formic acid (PubChem CID 171710054) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is 1-[2-[5-cyclohex-3-en-1-yl-4-(3-methoxyphenyl)imidazol-1-yl]ethyl]pyrrolidin-2-one;formic acid.
| Compound Name | 1-[2-[5-cyclohex-3-en-1-yl-4-(3-methoxyphenyl)imidazol-1-yl]ethyl]pyrrolidin-2-one;formic acid |
|---|---|
| PubChem CID | 171710054 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 1-[2-[5-cyclohex-3-en-1-yl-4-(3-methoxyphenyl)imidazol-1-yl]ethyl]pyrrolidin-2-one;formic acid |
| SMILES | COc1cccc(-c2ncn(CCN3CCCC3=O)c2C2CC=CCC2)c1.O=CO |
| InChI | InChI=1S/C22H27N3O2.CH2O2/c1-27-19-10-5-9-18(15-19)21-22(17-7-3-2-4-8-17)25(16-23-21)14-13-24-12-6-11-20(24)26;2-1-3/h2-3,5,9-10,15-17H,4,6-8,11-14H2,1H3;1H,(H,2,3) |
| InChIKey | PTHSGYGRCCLMTL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|