C19H19N3O2 — CID 172673795
5-cyclohex-3-en-1-yl-3-(3-methoxyphenyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 172673795) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is 5-cyclohex-3-en-1-yl-3-(3-methoxyphenyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 5-cyclohex-3-en-1-yl-3-(3-methoxyphenyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 172673795 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 5-cyclohex-3-en-1-yl-3-(3-methoxyphenyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | COc1cccc(-c2c[nH]n3c(=O)cc(C4CC=CCC4)nc23)c1 |
| InChI | InChI=1S/C19H19N3O2/c1-24-15-9-5-8-14(10-15)16-12-20-22-18(23)11-17(21-19(16)22)13-6-3-2-4-7-13/h2-3,5,8-13,20H,4,6-7H2,1H3 |
| InChIKey | FHHBUGKRYDVJEU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|