C18H23N5O5S — CID 171339266
formic acid;2-[4-(3-methoxyphenyl)-5-(1-methylpyrazol-3-yl)imidazol-1-yl]-N-methylethanesulfonamide (PubChem CID 171339266) has the molecular formula C18H23N5O5S and a molecular weight of 421.48 g/mol. Its IUPAC name is formic acid;2-[4-(3-methoxyphenyl)-5-(1-methylpyrazol-3-yl)imidazol-1-yl]-N-methylethanesulfonamide.
| Compound Name | formic acid;2-[4-(3-methoxyphenyl)-5-(1-methylpyrazol-3-yl)imidazol-1-yl]-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 171339266 |
| Molecular Formula | C18H23N5O5S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | formic acid;2-[4-(3-methoxyphenyl)-5-(1-methylpyrazol-3-yl)imidazol-1-yl]-N-methylethanesulfonamide |
| SMILES | CNS(=O)(=O)CCn1cnc(-c2cccc(OC)c2)c1-c1ccn(C)n1.O=CO |
| InChI | InChI=1S/C17H21N5O3S.CH2O2/c1-18-26(23,24)10-9-22-12-19-16(13-5-4-6-14(11-13)25-3)17(22)15-7-8-21(2)20-15;2-1-3/h4-8,11-12,18H,9-10H2,1-3H3;1H,(H,2,3) |
| InChIKey | PEDGGQCPUSRJDL-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 128.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|