C28H25N3O4S — CID 171341776
ethyl 3-[(4-aminonaphthalen-1-yl)-(4-methylphenyl)sulfonylamino]-1H-indole-2-carboxylate (PubChem CID 171341776) has the molecular formula C28H25N3O4S and a molecular weight of 499.59 g/mol. Its IUPAC name is ethyl 3-[(4-aminonaphthalen-1-yl)-(4-methylphenyl)sulfonylamino]-1H-indole-2-carboxylate.
| Compound Name | ethyl 3-[(4-aminonaphthalen-1-yl)-(4-methylphenyl)sulfonylamino]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 171341776 |
| Molecular Formula | C28H25N3O4S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | ethyl 3-[(4-aminonaphthalen-1-yl)-(4-methylphenyl)sulfonylamino]-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2ccccc2c1N(c1ccc(N)c2ccccc12)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H25N3O4S/c1-3-35-28(32)26-27(22-10-6-7-11-24(22)30-26)31(36(33,34)19-14-12-18(2)13-15-19)25-17-16-23(29)20-8-4-5-9-21(20)25/h4-17,30H,3,29H2,1-2H3 |
| InChIKey | NACQYVLVWGAPOX-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|