C20H34N2O5 — CID 171342242
tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(piperidine-1-carbonyl)pent-4-enoate (PubChem CID 171342242) has the molecular formula C20H34N2O5 and a molecular weight of 382.50 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(piperidine-1-carbonyl)pent-4-enoate.
| Compound Name | tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(piperidine-1-carbonyl)pent-4-enoate |
|---|---|
| PubChem CID | 171342242 |
| Molecular Formula | C20H34N2O5 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(piperidine-1-carbonyl)pent-4-enoate |
| SMILES | C=C(C[C@H](NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C20H34N2O5/c1-14(16(23)22-11-9-8-10-12-22)13-15(17(24)26-19(2,3)4)21-18(25)27-20(5,6)7/h15H,1,8-13H2,2-7H3,(H,21,25)/t15-/m0/s1 |
| InChIKey | AMBJVIJVGSBTGM-HNNXBMFYSA-N |
| XLogP | 3.18 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|