C21H24N2O4 — CID 171342978
butyl 2-[2-(dimethylamino)ethyl]-1,3-dioxobenzo[de]isoquinoline-6-carboxylate (PubChem CID 171342978) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is butyl 2-[2-(dimethylamino)ethyl]-1,3-dioxobenzo[de]isoquinoline-6-carboxylate.
| Compound Name | butyl 2-[2-(dimethylamino)ethyl]-1,3-dioxobenzo[de]isoquinoline-6-carboxylate |
|---|---|
| PubChem CID | 171342978 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | butyl 2-[2-(dimethylamino)ethyl]-1,3-dioxobenzo[de]isoquinoline-6-carboxylate |
| SMILES | CCCCOC(=O)c1ccc2c3c(cccc13)C(=O)N(CCN(C)C)C2=O |
| InChI | InChI=1S/C21H24N2O4/c1-4-5-13-27-21(26)15-9-10-17-18-14(15)7-6-8-16(18)19(24)23(20(17)25)12-11-22(2)3/h6-10H,4-5,11-13H2,1-3H3 |
| InChIKey | TZCAIIHSDNFASX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|