C12H13Cl3N2O3S — CID 171346399
2,2,2-trichloroethyl 2-[[(2S)-pyrrolidine-2-carbonyl]amino]thiophene-3-carboxylate (PubChem CID 171346399) has the molecular formula C12H13Cl3N2O3S and a molecular weight of 371.67 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 2-[[(2S)-pyrrolidine-2-carbonyl]amino]thiophene-3-carboxylate.
| Compound Name | 2,2,2-trichloroethyl 2-[[(2S)-pyrrolidine-2-carbonyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 171346399 |
| Molecular Formula | C12H13Cl3N2O3S |
| Molecular Weight | 371.67 g/mol |
| Exact Mass | 369.97 |
| IUPAC Name | 2,2,2-trichloroethyl 2-[[(2S)-pyrrolidine-2-carbonyl]amino]thiophene-3-carboxylate |
| SMILES | O=C(OCC(Cl)(Cl)Cl)c1ccsc1NC(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C12H13Cl3N2O3S/c13-12(14,15)6-20-11(19)7-3-5-21-10(7)17-9(18)8-2-1-4-16-8/h3,5,8,16H,1-2,4,6H2,(H,17,18)/t8-/m0/s1 |
| InChIKey | USSUVYFSDKPXSW-QMMMGPOBSA-N |
| XLogP | 2.97 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.67 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|