C24H21F6NO3 — CID 171347138
(1S,12S,14R)-4-[3,5-bis(trifluoromethyl)phenyl]-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol (PubChem CID 171347138) has the molecular formula C24H21F6NO3 and a molecular weight of 485.42 g/mol. Its IUPAC name is (1S,12S,14R)-4-[3,5-bis(trifluoromethyl)phenyl]-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol.
| Compound Name | (1S,12S,14R)-4-[3,5-bis(trifluoromethyl)phenyl]-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol |
|---|---|
| PubChem CID | 171347138 |
| Molecular Formula | C24H21F6NO3 |
| Molecular Weight | 485.42 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | (1S,12S,14R)-4-[3,5-bis(trifluoromethyl)phenyl]-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol |
| SMILES | COc1ccc2c3c1O[C@H]1C[C@@H](O)C=C[C@@]31CCN(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C2 |
| InChI | InChI=1S/C24H21F6NO3/c1-33-18-3-2-13-12-31(16-9-14(23(25,26)27)8-15(10-16)24(28,29)30)7-6-22-5-4-17(32)11-19(22)34-21(18)20(13)22/h2-5,8-10,17,19,32H,6-7,11-12H2,1H3/t17-,19-,22-/m0/s1 |
| InChIKey | BSPDXWSTDMDCET-JLMWRMLUSA-N |
| XLogP | 5.46 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.42 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|