C21H21FN2O3 — CID 171342517
(1S,12S,14R)-4-(3-fluoro-2-pyridinyl)-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol (PubChem CID 171342517) has the molecular formula C21H21FN2O3 and a molecular weight of 368.41 g/mol. Its IUPAC name is (1S,12S,14R)-4-(3-fluoro-2-pyridinyl)-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol.
| Compound Name | (1S,12S,14R)-4-(3-fluoro-2-pyridinyl)-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol |
|---|---|
| PubChem CID | 171342517 |
| Molecular Formula | C21H21FN2O3 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | (1S,12S,14R)-4-(3-fluoro-2-pyridinyl)-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol |
| SMILES | COc1ccc2c3c1O[C@H]1C[C@@H](O)C=C[C@@]31CCN(c1ncccc1F)C2 |
| InChI | InChI=1S/C21H21FN2O3/c1-26-16-5-4-13-12-24(20-15(22)3-2-9-23-20)10-8-21-7-6-14(25)11-17(21)27-19(16)18(13)21/h2-7,9,14,17,25H,8,10-12H2,1H3/t14-,17-,21-/m0/s1 |
| InChIKey | HUGOFVFXBWIHPQ-LFRPXUGBSA-N |
| XLogP | 2.96 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|