C27H38N6O3 — CID 71209891
4-[4,6-bis(diethylamino)-1,3,5-triazin-2-yl]-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol (PubChem CID 71209891) has the molecular formula C27H38N6O3 and a molecular weight of 494.64 g/mol. Its IUPAC name is 4-[4,6-bis(diethylamino)-1,3,5-triazin-2-yl]-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol.
| Compound Name | 4-[4,6-bis(diethylamino)-1,3,5-triazin-2-yl]-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol |
|---|---|
| PubChem CID | 71209891 |
| Molecular Formula | C27H38N6O3 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.30 |
| IUPAC Name | 4-[4,6-bis(diethylamino)-1,3,5-triazin-2-yl]-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol |
| SMILES | CCN(CC)c1nc(N(CC)CC)nc(N2CCC34C=CC(O)CC3Oc3c(OC)ccc(c34)C2)n1 |
| InChI | InChI=1S/C27H38N6O3/c1-6-31(7-2)24-28-25(32(8-3)9-4)30-26(29-24)33-15-14-27-13-12-19(34)16-21(27)36-23-20(35-5)11-10-18(17-33)22(23)27/h10-13,19,21,34H,6-9,14-17H2,1-5H3 |
| InChIKey | UCNBQXNBLHBRGF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 87.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|