C25H32N4O4 — CID 21076646
4-[2-[3-(dimethylamino)propoxy]pyrimidin-4-yl]-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol (PubChem CID 21076646) has the molecular formula C25H32N4O4 and a molecular weight of 452.56 g/mol. Its IUPAC name is 4-[2-[3-(dimethylamino)propoxy]pyrimidin-4-yl]-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol.
| Compound Name | 4-[2-[3-(dimethylamino)propoxy]pyrimidin-4-yl]-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol |
|---|---|
| PubChem CID | 21076646 |
| Molecular Formula | C25H32N4O4 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | 4-[2-[3-(dimethylamino)propoxy]pyrimidin-4-yl]-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol |
| SMILES | COc1ccc2c3c1OC1CC(O)C=CC31CCN(c1ccnc(OCCCN(C)C)n1)C2 |
| InChI | InChI=1S/C25H32N4O4/c1-28(2)12-4-14-32-24-26-11-8-21(27-24)29-13-10-25-9-7-18(30)15-20(25)33-23-19(31-3)6-5-17(16-29)22(23)25/h5-9,11,18,20,30H,4,10,12-16H2,1-3H3 |
| InChIKey | IQTUOHVFMXAPNJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 80.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|