C23H26N2O4 — CID 171352025
(1S,12S,14R)-4-(5-ethoxy-2-pyridinyl)-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol (PubChem CID 171352025) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is (1S,12S,14R)-4-(5-ethoxy-2-pyridinyl)-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol.
| Compound Name | (1S,12S,14R)-4-(5-ethoxy-2-pyridinyl)-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol |
|---|---|
| PubChem CID | 171352025 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | (1S,12S,14R)-4-(5-ethoxy-2-pyridinyl)-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol |
| SMILES | CCOc1ccc(N2CC[C@@]34C=C[C@H](O)C[C@@H]3Oc3c(OC)ccc(c34)C2)nc1 |
| InChI | InChI=1S/C23H26N2O4/c1-3-28-17-5-7-20(24-13-17)25-11-10-23-9-8-16(26)12-19(23)29-22-18(27-2)6-4-15(14-25)21(22)23/h4-9,13,16,19,26H,3,10-12,14H2,1-2H3/t16-,19-,23-/m0/s1 |
| InChIKey | CEXKHWZBVBTCTQ-NVVBAYIOSA-N |
| XLogP | 3.22 |
| TPSA | 64.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|