C23H22F3NO3 — CID 171349041
(1S,12S,14R)-9-methoxy-4-[3-(trifluoromethyl)phenyl]-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol (PubChem CID 171349041) has the molecular formula C23H22F3NO3 and a molecular weight of 417.43 g/mol. Its IUPAC name is (1S,12S,14R)-9-methoxy-4-[3-(trifluoromethyl)phenyl]-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol.
| Compound Name | (1S,12S,14R)-9-methoxy-4-[3-(trifluoromethyl)phenyl]-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol |
|---|---|
| PubChem CID | 171349041 |
| Molecular Formula | C23H22F3NO3 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | (1S,12S,14R)-9-methoxy-4-[3-(trifluoromethyl)phenyl]-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol |
| SMILES | COc1ccc2c3c1O[C@H]1C[C@@H](O)C=C[C@@]31CCN(c1cccc(C(F)(F)F)c1)C2 |
| InChI | InChI=1S/C23H22F3NO3/c1-29-18-6-5-14-13-27(16-4-2-3-15(11-16)23(24,25)26)10-9-22-8-7-17(28)12-19(22)30-21(18)20(14)22/h2-8,11,17,19,28H,9-10,12-13H2,1H3/t17-,19-,22-/m0/s1 |
| InChIKey | TTZACHZBCWNVMR-JLMWRMLUSA-N |
| XLogP | 4.44 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|