C26H26F3NO4 — CID 162571134
[(1S,14R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl]methyl 3-(trifluoromethyl)benzoate (PubChem CID 162571134) has the molecular formula C26H26F3NO4 and a molecular weight of 473.49 g/mol. Its IUPAC name is [(1S,14R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl]methyl 3-(trifluoromethyl)benzoate.
| Compound Name | [(1S,14R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl]methyl 3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 162571134 |
| Molecular Formula | C26H26F3NO4 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | [(1S,14R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl]methyl 3-(trifluoromethyl)benzoate |
| SMILES | COc1ccc2c3c1OC1C[C@@H](COC(=O)c4cccc(C(F)(F)F)c4)C=C[C@@]31CCN(C)C2 |
| InChI | InChI=1S/C26H26F3NO4/c1-30-11-10-25-9-8-16(15-33-24(31)17-4-3-5-19(13-17)26(27,28)29)12-21(25)34-23-20(32-2)7-6-18(14-30)22(23)25/h3-9,13,16,21H,10-12,14-15H2,1-2H3/t16-,21?,25-/m0/s1 |
| InChIKey | QEFZHFCSEWYTBF-QFLNXZQOSA-N |
| XLogP | 4.98 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|