C28H33F3O3 — CID 171348290
[(3S,5S,8R,9S,10S,13S,14S,16Z)-16-benzylidene-10,13-dimethyl-17-oxo-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,2,2-trifluoroacetate (PubChem CID 171348290) has the molecular formula C28H33F3O3 and a molecular weight of 474.56 g/mol. Its IUPAC name is [(3S,5S,8R,9S,10S,13S,14S,16Z)-16-benzylidene-10,13-dimethyl-17-oxo-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(3S,5S,8R,9S,10S,13S,14S,16Z)-16-benzylidene-10,13-dimethyl-17-oxo-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 171348290 |
| Molecular Formula | C28H33F3O3 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | [(3S,5S,8R,9S,10S,13S,14S,16Z)-16-benzylidene-10,13-dimethyl-17-oxo-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,2,2-trifluoroacetate |
| SMILES | C[C@]12CC[C@H](OC(=O)C(F)(F)F)C[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)/C(=C\c3ccccc3)C[C@@H]12 |
| InChI | InChI=1S/C28H33F3O3/c1-26-12-10-20(34-25(33)28(29,30)31)16-19(26)8-9-21-22(26)11-13-27(2)23(21)15-18(24(27)32)14-17-6-4-3-5-7-17/h3-7,14,19-23H,8-13,15-16H2,1-2H3/b18-14-/t19-,20-,21+,22-,23-,26-,27-/m0/s1 |
| InChIKey | WBWXEMJWGYLJBF-KCKDAAEPSA-N |
| XLogP | 6.77 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|