C20H16N4OS2 — CID 171354989
3-methyl-5-oxo-N-phenyl-1-(4-phenyl-1,3-thiazol-2-yl)-4H-pyrazole-4-carbothioamide (PubChem CID 171354989) has the molecular formula C20H16N4OS2 and a molecular weight of 392.51 g/mol. Its IUPAC name is 3-methyl-5-oxo-N-phenyl-1-(4-phenyl-1,3-thiazol-2-yl)-4H-pyrazole-4-carbothioamide.
| Compound Name | 3-methyl-5-oxo-N-phenyl-1-(4-phenyl-1,3-thiazol-2-yl)-4H-pyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 171354989 |
| Molecular Formula | C20H16N4OS2 |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 3-methyl-5-oxo-N-phenyl-1-(4-phenyl-1,3-thiazol-2-yl)-4H-pyrazole-4-carbothioamide |
| SMILES | CC1=NN(c2nc(-c3ccccc3)cs2)C(=O)C1C(=S)Nc1ccccc1 |
| InChI | InChI=1S/C20H16N4OS2/c1-13-17(18(26)21-15-10-6-3-7-11-15)19(25)24(23-13)20-22-16(12-27-20)14-8-4-2-5-9-14/h2-12,17H,1H3,(H,21,26) |
| InChIKey | GVNAULKFMWERSW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|