C15H13N3O3S — CID 794174
ethyl (4S)-5-oxo-1-(4-phenyl-1,3-thiazol-2-yl)-4H-pyrazole-4-carboxylate (PubChem CID 794174) has the molecular formula C15H13N3O3S and a molecular weight of 315.35 g/mol. Its IUPAC name is ethyl (4S)-5-oxo-1-(4-phenyl-1,3-thiazol-2-yl)-4H-pyrazole-4-carboxylate.
| Compound Name | ethyl (4S)-5-oxo-1-(4-phenyl-1,3-thiazol-2-yl)-4H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 794174 |
| Molecular Formula | C15H13N3O3S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | ethyl (4S)-5-oxo-1-(4-phenyl-1,3-thiazol-2-yl)-4H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)[C@H]1C=NN(c2nc(-c3ccccc3)cs2)C1=O |
| InChI | InChI=1S/C15H13N3O3S/c1-2-21-14(20)11-8-16-18(13(11)19)15-17-12(9-22-15)10-6-4-3-5-7-10/h3-9,11H,2H2,1H3/t11-/m0/s1 |
| InChIKey | KBYRBTOZJDEBEW-NSHDSACASA-N |
| XLogP | 2.32 |
| TPSA | 71.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|