C21H17N3O3S2 — CID 4546410
2-[3-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 4546410) has the molecular formula C21H17N3O3S2 and a molecular weight of 423.52 g/mol. Its IUPAC name is 2-[3-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[3-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 4546410 |
| Molecular Formula | C21H17N3O3S2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | 2-[3-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | Cc1ccc(-c2csc(N3C(=O)C(CC(=O)O)S/C3=N\c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C21H17N3O3S2/c1-13-7-9-14(10-8-13)16-12-28-20(23-16)24-19(27)17(11-18(25)26)29-21(24)22-15-5-3-2-4-6-15/h2-10,12,17H,11H2,1H3,(H,25,26)/b22-21- |
| InChIKey | RZZGKKBLUSTZMQ-DQRAZIAOSA-N |
| XLogP | 4.73 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|