C24H21N3O4S2 — CID 4127444
2-[3-(4-methylphenyl)sulfonyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]-N-phenylacetamide (PubChem CID 4127444) has the molecular formula C24H21N3O4S2 and a molecular weight of 479.58 g/mol. Its IUPAC name is 2-[3-(4-methylphenyl)sulfonyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]-N-phenylacetamide.
| Compound Name | 2-[3-(4-methylphenyl)sulfonyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 4127444 |
| Molecular Formula | C24H21N3O4S2 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | 2-[3-(4-methylphenyl)sulfonyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]-N-phenylacetamide |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)C(CC(=O)Nc3ccccc3)S/C2=N\c2ccccc2)cc1 |
| InChI | InChI=1S/C24H21N3O4S2/c1-17-12-14-20(15-13-17)33(30,31)27-23(29)21(16-22(28)25-18-8-4-2-5-9-18)32-24(27)26-19-10-6-3-7-11-19/h2-15,21H,16H2,1H3,(H,25,28)/b26-24- |
| InChIKey | OCPCHSJZXLPHNS-LCUIJRPUSA-N |
| XLogP | 4.34 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|