C20H19N3O4S2 — CID 2104628
2-[(5R)-3-(benzenesulfonyl)-4-oxo-2-prop-2-enylimino-1,3-thiazolidin-5-yl]-N-phenylacetamide (PubChem CID 2104628) has the molecular formula C20H19N3O4S2 and a molecular weight of 429.52 g/mol. Its IUPAC name is 2-[(5R)-3-(benzenesulfonyl)-4-oxo-2-prop-2-enylimino-1,3-thiazolidin-5-yl]-N-phenylacetamide.
| Compound Name | 2-[(5R)-3-(benzenesulfonyl)-4-oxo-2-prop-2-enylimino-1,3-thiazolidin-5-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 2104628 |
| Molecular Formula | C20H19N3O4S2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | 2-[(5R)-3-(benzenesulfonyl)-4-oxo-2-prop-2-enylimino-1,3-thiazolidin-5-yl]-N-phenylacetamide |
| SMILES | C=CC/N=C1\S[C@H](CC(=O)Nc2ccccc2)C(=O)N1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H19N3O4S2/c1-2-13-21-20-23(29(26,27)16-11-7-4-8-12-16)19(25)17(28-20)14-18(24)22-15-9-5-3-6-10-15/h2-12,17H,1,13-14H2,(H,22,24)/b21-20-/t17-/m1/s1 |
| InChIKey | ZROHULJGPCPVHR-QBEKEKFNSA-N |
| XLogP | 2.89 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|