C21H21N3O4S2 — CID 4283778
2-[3-(4-methylphenyl)sulfonyl-4-oxo-2-prop-2-enylimino-1,3-thiazolidin-5-yl]-N-phenylacetamide (PubChem CID 4283778) has the molecular formula C21H21N3O4S2 and a molecular weight of 443.55 g/mol. Its IUPAC name is 2-[3-(4-methylphenyl)sulfonyl-4-oxo-2-prop-2-enylimino-1,3-thiazolidin-5-yl]-N-phenylacetamide.
| Compound Name | 2-[3-(4-methylphenyl)sulfonyl-4-oxo-2-prop-2-enylimino-1,3-thiazolidin-5-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 4283778 |
| Molecular Formula | C21H21N3O4S2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | 2-[3-(4-methylphenyl)sulfonyl-4-oxo-2-prop-2-enylimino-1,3-thiazolidin-5-yl]-N-phenylacetamide |
| SMILES | C=CC/N=C1\SC(CC(=O)Nc2ccccc2)C(=O)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H21N3O4S2/c1-3-13-22-21-24(30(27,28)17-11-9-15(2)10-12-17)20(26)18(29-21)14-19(25)23-16-7-5-4-6-8-16/h3-12,18H,1,13-14H2,2H3,(H,23,25)/b22-21- |
| InChIKey | RUHWNZWCJGOJSC-DQRAZIAOSA-N |
| XLogP | 3.20 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|