C16H17N3O8 — CID 171358847
[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl 4-amino-2-hydroxybenzoate (PubChem CID 171358847) has the molecular formula C16H17N3O8 and a molecular weight of 379.33 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl 4-amino-2-hydroxybenzoate.
| Compound Name | [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl 4-amino-2-hydroxybenzoate |
|---|---|
| PubChem CID | 171358847 |
| Molecular Formula | C16H17N3O8 |
| Molecular Weight | 379.33 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl 4-amino-2-hydroxybenzoate |
| SMILES | Nc1ccc(C(=O)OC[C@H]2O[C@@H](n3ccc(=O)[nH]c3=O)[C@H](O)[C@@H]2O)c(O)c1 |
| InChI | InChI=1S/C16H17N3O8/c17-7-1-2-8(9(20)5-7)15(24)26-6-10-12(22)13(23)14(27-10)19-4-3-11(21)18-16(19)25/h1-5,10,12-14,20,22-23H,6,17H2,(H,18,21,25)/t10-,12-,13-,14-/m1/s1 |
| InChIKey | NBJLBIIZUDOBFX-FMKGYKFTSA-N |
| XLogP | -1.70 |
| TPSA | 177.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.33 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|