C27H32N2O3 — CID 171358988
(4-hydroxy-3-methoxycyclohexyl)-[4-(2-phenyl-1H-indol-3-yl)piperidin-1-yl]methanone (PubChem CID 171358988) has the molecular formula C27H32N2O3 and a molecular weight of 432.56 g/mol. Its IUPAC name is (4-hydroxy-3-methoxycyclohexyl)-[4-(2-phenyl-1H-indol-3-yl)piperidin-1-yl]methanone.
| Compound Name | (4-hydroxy-3-methoxycyclohexyl)-[4-(2-phenyl-1H-indol-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 171358988 |
| Molecular Formula | C27H32N2O3 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | (4-hydroxy-3-methoxycyclohexyl)-[4-(2-phenyl-1H-indol-3-yl)piperidin-1-yl]methanone |
| SMILES | COC1CC(C(=O)N2CCC(c3c(-c4ccccc4)[nH]c4ccccc34)CC2)CCC1O |
| InChI | InChI=1S/C27H32N2O3/c1-32-24-17-20(11-12-23(24)30)27(31)29-15-13-18(14-16-29)25-21-9-5-6-10-22(21)28-26(25)19-7-3-2-4-8-19/h2-10,18,20,23-24,28,30H,11-17H2,1H3 |
| InChIKey | RPOVOZFGQUYNBS-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |