C20H22N4O — CID 171359910
4-phenyl-2-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol (PubChem CID 171359910) has the molecular formula C20H22N4O and a molecular weight of 334.42 g/mol. Its IUPAC name is 4-phenyl-2-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol.
| Compound Name | 4-phenyl-2-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol |
|---|---|
| PubChem CID | 171359910 |
| Molecular Formula | C20H22N4O |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 4-phenyl-2-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol |
| SMILES | OC1(c2ccccc2)CCCC2CN(c3ncnc4[nH]ccc34)CC21 |
| InChI | InChI=1S/C20H22N4O/c25-20(15-6-2-1-3-7-15)9-4-5-14-11-24(12-17(14)20)19-16-8-10-21-18(16)22-13-23-19/h1-3,6-8,10,13-14,17,25H,4-5,9,11-12H2,(H,21,22,23) |
| InChIKey | IRNHOWGDFCGZRV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |