C20H21NO4S2 — CID 171360008
(1R,8S)-8-(benzenesulfonyl)-2-(4-methylphenyl)sulfonyl-2-azabicyclo[4.2.0]oct-5-ene (PubChem CID 171360008) has the molecular formula C20H21NO4S2 and a molecular weight of 403.53 g/mol. Its IUPAC name is (1R,8S)-8-(benzenesulfonyl)-2-(4-methylphenyl)sulfonyl-2-azabicyclo[4.2.0]oct-5-ene.
| Compound Name | (1R,8S)-8-(benzenesulfonyl)-2-(4-methylphenyl)sulfonyl-2-azabicyclo[4.2.0]oct-5-ene |
|---|---|
| PubChem CID | 171360008 |
| Molecular Formula | C20H21NO4S2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | (1R,8S)-8-(benzenesulfonyl)-2-(4-methylphenyl)sulfonyl-2-azabicyclo[4.2.0]oct-5-ene |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC=C3C[C@H](S(=O)(=O)c4ccccc4)[C@@H]32)cc1 |
| InChI | InChI=1S/C20H21NO4S2/c1-15-9-11-18(12-10-15)27(24,25)21-13-5-6-16-14-19(20(16)21)26(22,23)17-7-3-2-4-8-17/h2-4,6-12,19-20H,5,13-14H2,1H3/t19-,20+/m0/s1 |
| InChIKey | HAJVBZHRTOTEAJ-VQTJNVASSA-N |
| XLogP | 2.93 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|