C13H14ClNO3S — CID 150636030
6-chloro-1-(4-methylphenyl)sulfonyl-3,6-dihydro-2H-pyridine-5-carbaldehyde (PubChem CID 150636030) has the molecular formula C13H14ClNO3S and a molecular weight of 299.78 g/mol. Its IUPAC name is 6-chloro-1-(4-methylphenyl)sulfonyl-3,6-dihydro-2H-pyridine-5-carbaldehyde.
| Compound Name | 6-chloro-1-(4-methylphenyl)sulfonyl-3,6-dihydro-2H-pyridine-5-carbaldehyde |
|---|---|
| PubChem CID | 150636030 |
| Molecular Formula | C13H14ClNO3S |
| Molecular Weight | 299.78 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 6-chloro-1-(4-methylphenyl)sulfonyl-3,6-dihydro-2H-pyridine-5-carbaldehyde |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC=C(C=O)C2Cl)cc1 |
| InChI | InChI=1S/C13H14ClNO3S/c1-10-4-6-12(7-5-10)19(17,18)15-8-2-3-11(9-16)13(15)14/h3-7,9,13H,2,8H2,1H3 |
| InChIKey | IYXGIAJZTXJUJD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.78 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|