C16H22BFO2 — CID 171362138
2-[(E)-4-(3-fluorophenyl)but-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171362138) has the molecular formula C16H22BFO2 and a molecular weight of 276.16 g/mol. Its IUPAC name is 2-[(E)-4-(3-fluorophenyl)but-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(E)-4-(3-fluorophenyl)but-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171362138 |
| Molecular Formula | C16H22BFO2 |
| Molecular Weight | 276.16 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 2-[(E)-4-(3-fluorophenyl)but-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(/C=C/CCc2cccc(F)c2)OC1(C)C |
| InChI | InChI=1S/C16H22BFO2/c1-15(2)16(3,4)20-17(19-15)11-6-5-8-13-9-7-10-14(18)12-13/h6-7,9-12H,5,8H2,1-4H3/b11-6+ |
| InChIKey | LWQAFMRJHKOELH-IZZDOVSWSA-N |
| XLogP | 3.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.16 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|