C10H5F5N4O2 — CID 171362997
4-(4-nitrophenyl)-1-(1,1,2,2,2-pentafluoroethyl)triazole (PubChem CID 171362997) has the molecular formula C10H5F5N4O2 and a molecular weight of 308.17 g/mol. Its IUPAC name is 4-(4-nitrophenyl)-1-(1,1,2,2,2-pentafluoroethyl)triazole.
| Compound Name | 4-(4-nitrophenyl)-1-(1,1,2,2,2-pentafluoroethyl)triazole |
|---|---|
| PubChem CID | 171362997 |
| Molecular Formula | C10H5F5N4O2 |
| Molecular Weight | 308.17 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 4-(4-nitrophenyl)-1-(1,1,2,2,2-pentafluoroethyl)triazole |
| SMILES | O=[N+]([O-])c1ccc(-c2cn(C(F)(F)C(F)(F)F)nn2)cc1 |
| InChI | InChI=1S/C10H5F5N4O2/c11-9(12,13)10(14,15)18-5-8(16-17-18)6-1-3-7(4-2-6)19(20)21/h1-5H |
| InChIKey | BWBFRMPGAIGFHE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.17 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|