C15H19FN4O2 — CID 70800449
1-[2-(fluoromethyl)-3,3-dimethylbutyl]-4-(4-nitrophenyl)triazole (PubChem CID 70800449) has the molecular formula C15H19FN4O2 and a molecular weight of 306.34 g/mol. Its IUPAC name is 1-[2-(fluoromethyl)-3,3-dimethylbutyl]-4-(4-nitrophenyl)triazole.
| Compound Name | 1-[2-(fluoromethyl)-3,3-dimethylbutyl]-4-(4-nitrophenyl)triazole |
|---|---|
| PubChem CID | 70800449 |
| Molecular Formula | C15H19FN4O2 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 1-[2-(fluoromethyl)-3,3-dimethylbutyl]-4-(4-nitrophenyl)triazole |
| SMILES | CC(C)(C)C(CF)Cn1cc(-c2ccc([N+](=O)[O-])cc2)nn1 |
| InChI | InChI=1S/C15H19FN4O2/c1-15(2,3)12(8-16)9-19-10-14(17-18-19)11-4-6-13(7-5-11)20(21)22/h4-7,10,12H,8-9H2,1-3H3 |
| InChIKey | ITMJRLOSAIMKQZ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|