C15H19N3OS2 — CID 171363171
11-(diethylaminomethyl)-4,5-dimethyl-6,10-dithia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,11-tetraen-2-one (PubChem CID 171363171) has the molecular formula C15H19N3OS2 and a molecular weight of 321.47 g/mol. Its IUPAC name is 11-(diethylaminomethyl)-4,5-dimethyl-6,10-dithia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,11-tetraen-2-one.
| Compound Name | 11-(diethylaminomethyl)-4,5-dimethyl-6,10-dithia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,11-tetraen-2-one |
|---|---|
| PubChem CID | 171363171 |
| Molecular Formula | C15H19N3OS2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 11-(diethylaminomethyl)-4,5-dimethyl-6,10-dithia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,11-tetraen-2-one |
| SMILES | CCN(CC)Cc1cn2c(=O)c3c(C)c(C)sc3nc2s1 |
| InChI | InChI=1S/C15H19N3OS2/c1-5-17(6-2)7-11-8-18-14(19)12-9(3)10(4)20-13(12)16-15(18)21-11/h8H,5-7H2,1-4H3 |
| InChIKey | RSCRPJRJFNREKM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |