C10H17NO3 — CID 171365711
N-ethyl-2-[(1R,4S,5S)-4-hydroxy-5-(hydroxymethyl)cyclopent-2-en-1-yl]acetamide (PubChem CID 171365711) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is N-ethyl-2-[(1R,4S,5S)-4-hydroxy-5-(hydroxymethyl)cyclopent-2-en-1-yl]acetamide.
| Compound Name | N-ethyl-2-[(1R,4S,5S)-4-hydroxy-5-(hydroxymethyl)cyclopent-2-en-1-yl]acetamide |
|---|---|
| PubChem CID | 171365711 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | N-ethyl-2-[(1R,4S,5S)-4-hydroxy-5-(hydroxymethyl)cyclopent-2-en-1-yl]acetamide |
| SMILES | CCNC(=O)C[C@@H]1C=C[C@H](O)[C@@H]1CO |
| InChI | InChI=1S/C10H17NO3/c1-2-11-10(14)5-7-3-4-9(13)8(7)6-12/h3-4,7-9,12-13H,2,5-6H2,1H3,(H,11,14)/t7-,8+,9-/m0/s1 |
| InChIKey | CZYPEGCBYOFFPR-YIZRAAEISA-N |
| XLogP | -0.33 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|