C13H21N3O2S — CID 17136573
2-methylpropyl 2-[(5-ethyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetate (PubChem CID 17136573) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is 2-methylpropyl 2-[(5-ethyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetate.
| Compound Name | 2-methylpropyl 2-[(5-ethyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 17136573 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2-methylpropyl 2-[(5-ethyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetate |
| SMILES | C=CCn1c(CC)nnc1SCC(=O)OCC(C)C |
| InChI | InChI=1S/C13H21N3O2S/c1-5-7-16-11(6-2)14-15-13(16)19-9-12(17)18-8-10(3)4/h5,10H,1,6-9H2,2-4H3 |
| InChIKey | PUTCKYHMRQNAPQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|