C24H17NO3 — CID 171365877
methyl 3-oxo-1-[3-(2-phenylethynyl)phenyl]-2H-isoindole-1-carboxylate (PubChem CID 171365877) has the molecular formula C24H17NO3 and a molecular weight of 367.40 g/mol. Its IUPAC name is methyl 3-oxo-1-[3-(2-phenylethynyl)phenyl]-2H-isoindole-1-carboxylate.
| Compound Name | methyl 3-oxo-1-[3-(2-phenylethynyl)phenyl]-2H-isoindole-1-carboxylate |
|---|---|
| PubChem CID | 171365877 |
| Molecular Formula | C24H17NO3 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | methyl 3-oxo-1-[3-(2-phenylethynyl)phenyl]-2H-isoindole-1-carboxylate |
| SMILES | COC(=O)C1(c2cccc(C#Cc3ccccc3)c2)NC(=O)c2ccccc21 |
| InChI | InChI=1S/C24H17NO3/c1-28-23(27)24(21-13-6-5-12-20(21)22(26)25-24)19-11-7-10-18(16-19)15-14-17-8-3-2-4-9-17/h2-13,16H,1H3,(H,25,26) |
| InChIKey | ILMKQFOXYIWYQY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|