C22H16FNO3S — CID 176522414
methyl 1-(4-fluoro-3-phenylsulfanylphenyl)-3-oxo-2H-isoindole-1-carboxylate (PubChem CID 176522414) has the molecular formula C22H16FNO3S and a molecular weight of 393.44 g/mol. Its IUPAC name is methyl 1-(4-fluoro-3-phenylsulfanylphenyl)-3-oxo-2H-isoindole-1-carboxylate.
| Compound Name | methyl 1-(4-fluoro-3-phenylsulfanylphenyl)-3-oxo-2H-isoindole-1-carboxylate |
|---|---|
| PubChem CID | 176522414 |
| Molecular Formula | C22H16FNO3S |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | methyl 1-(4-fluoro-3-phenylsulfanylphenyl)-3-oxo-2H-isoindole-1-carboxylate |
| SMILES | COC(=O)C1(c2ccc(F)c(Sc3ccccc3)c2)NC(=O)c2ccccc21 |
| InChI | InChI=1S/C22H16FNO3S/c1-27-21(26)22(17-10-6-5-9-16(17)20(25)24-22)14-11-12-18(23)19(13-14)28-15-7-3-2-4-8-15/h2-13H,1H3,(H,24,25) |
| InChIKey | GZGPIZBDKZVJQQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |