C22H15F2NO3 — CID 176522456
methyl 1-[3-(2,4-difluorophenyl)phenyl]-3-oxo-2H-isoindole-1-carboxylate (PubChem CID 176522456) has the molecular formula C22H15F2NO3 and a molecular weight of 379.36 g/mol. Its IUPAC name is methyl 1-[3-(2,4-difluorophenyl)phenyl]-3-oxo-2H-isoindole-1-carboxylate.
| Compound Name | methyl 1-[3-(2,4-difluorophenyl)phenyl]-3-oxo-2H-isoindole-1-carboxylate |
|---|---|
| PubChem CID | 176522456 |
| Molecular Formula | C22H15F2NO3 |
| Molecular Weight | 379.36 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | methyl 1-[3-(2,4-difluorophenyl)phenyl]-3-oxo-2H-isoindole-1-carboxylate |
| SMILES | COC(=O)C1(c2cccc(-c3ccc(F)cc3F)c2)NC(=O)c2ccccc21 |
| InChI | InChI=1S/C22H15F2NO3/c1-28-21(27)22(18-8-3-2-7-17(18)20(26)25-22)14-6-4-5-13(11-14)16-10-9-15(23)12-19(16)24/h2-12H,1H3,(H,25,26) |
| InChIKey | NSPZWRNZOGTRFF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |