C16H11BrFNO3 — CID 176522440
methyl 1-(3-bromo-4-fluorophenyl)-3-oxo-2H-isoindole-1-carboxylate (PubChem CID 176522440) has the molecular formula C16H11BrFNO3 and a molecular weight of 364.17 g/mol. Its IUPAC name is methyl 1-(3-bromo-4-fluorophenyl)-3-oxo-2H-isoindole-1-carboxylate.
| Compound Name | methyl 1-(3-bromo-4-fluorophenyl)-3-oxo-2H-isoindole-1-carboxylate |
|---|---|
| PubChem CID | 176522440 |
| Molecular Formula | C16H11BrFNO3 |
| Molecular Weight | 364.17 g/mol |
| Exact Mass | 362.99 |
| IUPAC Name | methyl 1-(3-bromo-4-fluorophenyl)-3-oxo-2H-isoindole-1-carboxylate |
| SMILES | COC(=O)C1(c2ccc(F)c(Br)c2)NC(=O)c2ccccc21 |
| InChI | InChI=1S/C16H11BrFNO3/c1-22-15(21)16(9-6-7-13(18)12(17)8-9)11-5-3-2-4-10(11)14(20)19-16/h2-8H,1H3,(H,19,20) |
| InChIKey | DAJYCSKXMDNDHD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.17 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |