C22H17NO3Se — CID 176522425
methyl 3-oxo-1-(3-phenylselanylphenyl)-2H-isoindole-1-carboxylate (PubChem CID 176522425) has the molecular formula C22H17NO3Se and a molecular weight of 422.34 g/mol. Its IUPAC name is methyl 3-oxo-1-(3-phenylselanylphenyl)-2H-isoindole-1-carboxylate.
| Compound Name | methyl 3-oxo-1-(3-phenylselanylphenyl)-2H-isoindole-1-carboxylate |
|---|---|
| PubChem CID | 176522425 |
| Molecular Formula | C22H17NO3Se |
| Molecular Weight | 422.34 g/mol |
| Exact Mass | 423.04 |
| IUPAC Name | methyl 3-oxo-1-(3-phenylselanylphenyl)-2H-isoindole-1-carboxylate |
| SMILES | COC(=O)C1(c2cccc([Se]c3ccccc3)c2)NC(=O)c2ccccc21 |
| InChI | InChI=1S/C22H17NO3Se/c1-26-21(25)22(19-13-6-5-12-18(19)20(24)23-22)15-8-7-11-17(14-15)27-16-9-3-2-4-10-16/h2-14H,1H3,(H,23,24) |
| InChIKey | ZLEDDMFDWPSPNP-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|