C18H27ClN2O — CID 171370335
2,2,3,3,4,4,4-heptadeuterio-1-[2-methyl-4-(3-phenylprop-2-enyl)piperazin-1-yl]butan-1-one;hydrochloride (PubChem CID 171370335) has the molecular formula C18H27ClN2O and a molecular weight of 329.92 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptadeuterio-1-[2-methyl-4-(3-phenylprop-2-enyl)piperazin-1-yl]butan-1-one;hydrochloride.
| Compound Name | 2,2,3,3,4,4,4-heptadeuterio-1-[2-methyl-4-(3-phenylprop-2-enyl)piperazin-1-yl]butan-1-one;hydrochloride |
|---|---|
| PubChem CID | 171370335 |
| Molecular Formula | C18H27ClN2O |
| Molecular Weight | 329.92 g/mol |
| Exact Mass | 329.23 |
| IUPAC Name | 2,2,3,3,4,4,4-heptadeuterio-1-[2-methyl-4-(3-phenylprop-2-enyl)piperazin-1-yl]butan-1-one;hydrochloride |
| SMILES | Cl.[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)N1CCN(CC=Cc2ccccc2)CC1C |
| InChI | InChI=1S/C18H26N2O.ClH/c1-3-8-18(21)20-14-13-19(15-16(20)2)12-7-11-17-9-5-4-6-10-17;/h4-7,9-11,16H,3,8,12-15H2,1-2H3;1H/i1D3,3D2,8D2; |
| InChIKey | GPYVJSNBBPAWLD-YCWRBVNPSA-N |
| XLogP | 3.45 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.92 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |