C15H17N3O3 — CID 171373542
benzyl 3-(1,3,4-oxadiazol-2-yl)piperidine-1-carboxylate (PubChem CID 171373542) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is benzyl 3-(1,3,4-oxadiazol-2-yl)piperidine-1-carboxylate.
| Compound Name | benzyl 3-(1,3,4-oxadiazol-2-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 171373542 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | benzyl 3-(1,3,4-oxadiazol-2-yl)piperidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCCC(c2nnco2)C1 |
| InChI | InChI=1S/C15H17N3O3/c19-15(20-10-12-5-2-1-3-6-12)18-8-4-7-13(9-18)14-17-16-11-21-14/h1-3,5-6,11,13H,4,7-10H2 |
| InChIKey | KJDZRPOQXPRTEW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |