C11H13ClN2O4 — CID 171374849
CID 171374849 (PubChem CID 171374849) has the molecular formula C11H13ClN2O4 and a molecular weight of 272.69 g/mol.
| Compound Name | CID 171374849 |
|---|---|
| PubChem CID | 171374849 |
| Molecular Formula | C11H13ClN2O4 |
| Molecular Weight | 272.69 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | — |
| SMILES | CN(C)/C=C1\C=Nc2ccccc21.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C11H12N2.ClHO4/c1-13(2)8-9-7-12-11-6-4-3-5-10(9)11;2-1(3,4)5/h3-8H,1-2H3;(H,2,3,4,5)/b9-8+; |
| InChIKey | HIWKIPYTDJMMPL-HRNDJLQDSA-N |
| XLogP | -1.82 |
| TPSA | 105.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.69 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |