C21H27N2O9S- — CID 171376486
2-[carboxymethyl-[6-(2,5-dioxopyrrol-1-yl)hexyl]amino]acetate;4-methylbenzenesulfonic acid (PubChem CID 171376486) has the molecular formula C21H27N2O9S- and a molecular weight of 483.52 g/mol. Its IUPAC name is 2-[carboxymethyl-[6-(2,5-dioxopyrrol-1-yl)hexyl]amino]acetate;4-methylbenzenesulfonic acid.
| Compound Name | 2-[carboxymethyl-[6-(2,5-dioxopyrrol-1-yl)hexyl]amino]acetate;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 171376486 |
| Molecular Formula | C21H27N2O9S- |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | 2-[carboxymethyl-[6-(2,5-dioxopyrrol-1-yl)hexyl]amino]acetate;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.O=C([O-])CN(CCCCCCN1C(=O)C=CC1=O)CC(=O)O |
| InChI | InChI=1S/C14H20N2O6.C7H8O3S/c17-11-5-6-12(18)16(11)8-4-2-1-3-7-15(9-13(19)20)10-14(21)22;1-6-2-4-7(5-3-6)11(8,9)10/h5-6H,1-4,7-10H2,(H,19,20)(H,21,22);2-5H,1H3,(H,8,9,10)/p-1 |
| InChIKey | ONTBADWZONVLHF-UHFFFAOYSA-M |
| XLogP | -0.15 |
| TPSA | 172.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|